CAS 1379227-91-4

Methyl 5-amino-1-ethyl-1H-pyrrole-2-carboxylate

Description:

Methyl 5-amino-1-ethyl-1H-pyrrole-2-carboxylate is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an amino group and an ethyl substituent, contributing to its reactivity and potential biological activity. The carboxylate group indicates that it can participate in various chemical reactions, such as esterification or amidation. Its methyl ester form suggests it may be involved in synthetic pathways for pharmaceuticals or agrochemicals. The presence of the amino group can enhance its solubility in polar solvents and may also facilitate interactions with biological targets. As a relatively specialized compound, it may not be widely studied, but its structural features suggest potential applications in medicinal chemistry or as a building block in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, particularly those with biological activity.

Formula: C₈H₁₂N₂O₂

InChI: InChI=1S/C8H12N2O2/c1-3-10-6(8(11)12-2)4-5-7(10)9/h4-5H,3,9H2,1-2H3

SMILES: CCn1c(ccc1N)C(=O)OC

Synonyms:

• 1H-Pyrrole-2-carboxylic acid, 5-amino-1-ethyl-, methyl ester

Methyl 5-amino-1-ethyl-1H-pyrrole-2-carboxylate

CAS: 1379227-91-4

Formula: C₈H₁₂N₂O₂

Molecular weight: 168.1931

Ref: IN-DA00143P

Methyl 5-amino-1-ethyl-1H-pyrrole-2-carboxylate

CAS: 1379227-91-4

Methyl 5-amino-1-ethyl-1H-pyrrole-2-carboxylate

Purity: ≥95%

Molecular weight: 168.19g/mol

Ref: 54-OR305323