CAS 1379364-31-4
:3-(4-Bromo-2,5-difluorophenoxy)propanenitrile
Description:
3-(4-Bromo-2,5-difluorophenoxy)propanenitrile is a chemical compound characterized by its unique structure, which includes a propanenitrile group attached to a phenoxy moiety that is further substituted with bromine and fluorine atoms. The presence of the bromine atom and two fluorine atoms on the aromatic ring contributes to its potential reactivity and lipophilicity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The nitrile functional group (-C≡N) is notable for its ability to participate in nucleophilic reactions and can influence the compound's polarity and solubility. This compound may exhibit specific biological activities due to its structural features, which could be explored in medicinal chemistry. Additionally, the presence of halogens often enhances the compound's stability and can affect its interaction with biological targets. Overall, 3-(4-Bromo-2,5-difluorophenoxy)propanenitrile is a complex molecule with potential utility in synthetic chemistry and drug development.
Formula:C9H6BrF2NO
InChI:InChI=1S/C9H6BrF2NO/c10-6-4-8(12)9(5-7(6)11)14-3-1-2-13/h4-5H,1,3H2
InChI key:InChIKey=BFLCMYNHPCBHOU-UHFFFAOYSA-N
SMILES:O(CCC#N)C1=C(F)C=C(Br)C(F)=C1
Synonyms:- Propanenitrile, 3-(4-bromo-2,5-difluorophenoxy)-
- 3-(4-Bromo-2,5-difluorophenoxy)propanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.