CAS 1379526-96-1
:Ethyl 5,7-bis(trifluoromethyl)-1,8-naphthyridine-2-carboxylate
Description:
Ethyl 5,7-bis(trifluoromethyl)-1,8-naphthyridine-2-carboxylate is a chemical compound characterized by its complex structure, which includes a naphthyridine core substituted with two trifluoromethyl groups and an ethyl ester functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for diverse reactivity due to the presence of electron-withdrawing trifluoromethyl groups. The trifluoromethyl groups enhance lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. The ethyl ester moiety contributes to its solubility in organic solvents and may affect its reactivity in esterification or hydrolysis reactions. Additionally, the presence of the naphthyridine structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. Overall, this compound's unique structural features and functional groups make it a subject of interest for further research and application in various chemical and biological contexts.
Formula:C13H8F6N2O2
InChI:InChI=1S/C13H8F6N2O2/c1-2-23-11(22)8-4-3-6-7(12(14,15)16)5-9(13(17,18)19)21-10(6)20-8/h3-5H,2H2,1H3
InChI key:InChIKey=SOGQRHUEDKQABR-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C2=C(N=C(C(F)(F)F)C1)N=C(C(OCC)=O)C=C2
Synonyms:- 1,8-Naphthyridine-2-carboxylic acid, 5,7-bis(trifluoromethyl)-, ethyl ester
- Ethyl 5,7-bis(trifluoromethyl)-1,8-naphthyridine-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 5,7-bis(trifluoromethyl)-1,8-naphthyridine-2-carboxylate
CAS:Ethyl 5,7-bis(trifluoromethyl)-1,8-naphthyridine-2-carboxylate
Molecular weight:338.21g/mol
