CymitQuimica logo

CAS 1379526-97-2

:

Ethyl 6-(cyanophenylmethyl)-2-pyridinecarboxylate

Description:
Ethyl 6-(cyanophenylmethyl)-2-pyridinecarboxylate is a chemical compound characterized by its unique structure, which includes a pyridine ring and a cyanophenylmethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the cyano group. The ethyl ester functional group contributes to its reactivity, making it a candidate for various chemical transformations. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine moiety, which is often found in biologically active compounds. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the aromatic and heterocyclic systems. However, specific physical properties such as boiling point, melting point, and spectral data would require experimental determination or literature reference for precise characterization. Overall, this compound represents a versatile structure with potential implications in various fields of chemistry.
Formula:C16H14N2O2
InChI:InChI=1S/C16H14N2O2/c1-2-20-16(19)15-10-6-9-14(18-15)13(11-17)12-7-4-3-5-8-12/h3-10,13H,2H2,1H3
InChI key:InChIKey=KNFWODCGAQJLJN-UHFFFAOYSA-N
SMILES:C(C#N)(C=1N=C(C(OCC)=O)C=CC1)C2=CC=CC=C2
Synonyms:
  • Ethyl 6-(cyanophenylmethyl)-2-pyridinecarboxylate
  • 2-Pyridinecarboxylic acid, 6-(cyanophenylmethyl)-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.