CAS 1379527-00-0
:6-(Cyanophenylmethyl)-2-pyridinecarboxylic acid
Description:
6-(Cyanophenylmethyl)-2-pyridinecarboxylic acid, identified by its CAS number 1379527-00-0, is a chemical compound characterized by its unique structure that combines a pyridine ring with a carboxylic acid functional group and a cyanophenylmethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate polarity due to the presence of the carboxylic acid group. The cyanophenylmethyl moiety may impart specific electronic and steric effects, influencing its reactivity and interactions in various chemical environments. Such compounds are often of interest in medicinal chemistry and material science due to their potential biological activity and utility in synthesizing more complex molecules. Additionally, the presence of the pyridine ring suggests possible coordination with metal ions, which can be relevant in catalysis or as ligands in coordination chemistry. Overall, the characteristics of this compound make it a subject of interest for further research and application in various fields.
Formula:C14H10N2O2
InChI:InChI=1S/C14H10N2O2/c15-9-11(10-5-2-1-3-6-10)12-7-4-8-13(16-12)14(17)18/h1-8,11H,(H,17,18)
InChI key:InChIKey=JCQPALJUGWVYFA-UHFFFAOYSA-N
SMILES:C(C#N)(C=1N=C(C(O)=O)C=CC1)C2=CC=CC=C2
Synonyms:- 2-Pyridinecarboxylic acid, 6-(cyanophenylmethyl)-
- 6-(Cyanophenylmethyl)-2-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-[Cyano(phenyl)methyl]pyridine-2-carboxylic acid
CAS:6-[Cyano(phenyl)methyl]pyridine-2-carboxylic acid
Molecular weight:238.24g/mol
