
CAS 1379527-03-3
:1,2-Propanediamine, 2-methyl-N2-(phenylmethyl)-, hydrochloride (1:2)
Description:
1,2-Propanediamine, 2-methyl-N2-(phenylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its amine functional groups, specifically featuring a propanediamine backbone with a methyl group and a phenylmethyl substituent. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and stability. The presence of multiple amine groups suggests potential for hydrogen bonding and reactivity, making it of interest in various chemical applications, including pharmaceuticals and organic synthesis. The molecular structure indicates that it may exhibit basic properties due to the amine functionalities, and it may participate in reactions typical of amines, such as alkylation or acylation. Additionally, the phenylmethyl group can influence the compound's lipophilicity and biological activity. Safety data and handling precautions should be considered, as with any chemical substance, particularly those containing amine groups, which can be reactive and may pose health risks if not managed properly.
Formula:C11H18N2·2ClH
InChI:InChI=1S/C11H18N2.2ClH/c1-11(2,9-12)13-8-10-6-4-3-5-7-10;;/h3-7,13H,8-9,12H2,1-2H3;2*1H
InChI key:InChIKey=RWGVBNNHRZVBST-UHFFFAOYSA-N
SMILES:C(NC(CN)(C)C)C1=CC=CC=C1.Cl
Synonyms:- 1,2-Propanediamine, 2-methyl-N2-(phenylmethyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Benzyl-2-methylpropane-1,2-diamine dihydrochloride
CAS:N-Benzyl-2-methylpropane-1,2-diamine dihydrochloride
Molecular weight:251.20g/mol
