CymitQuimica logo

CAS 1379811-56-9

:

N-(4-Methyl-3-nitrophenyl)imidodicarbonimidic diamide

Description:
N-(4-Methyl-3-nitrophenyl)imidodicarbonimidic diamide, identified by its CAS number 1379811-56-9, is a chemical compound characterized by its complex structure, which includes an imidodicarbonimidic diamide backbone and a nitrophenyl substituent. This compound typically exhibits properties associated with both aromatic and amine functionalities, which may influence its reactivity and solubility in various solvents. The presence of the nitro group suggests potential for electrophilic reactivity, while the methyl group can affect steric hindrance and electronic properties. Such compounds often find applications in organic synthesis, pharmaceuticals, or as intermediates in chemical reactions. The stability and behavior of this substance under different conditions, such as temperature and pH, would be critical for its practical use. Additionally, safety data and handling precautions should be considered due to the potential toxicity associated with nitro compounds. Overall, the unique combination of functional groups in this compound contributes to its chemical behavior and potential applications in various fields.
Formula:C9H12N6O2
InChI:InChI=1S/C9H12N6O2/c1-5-2-3-6(4-7(5)15(16)17)13-9(12)14-8(10)11/h2-4H,1H3,(H6,10,11,12,13,14)
InChI key:InChIKey=LZUVDCBBUFSLHY-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC(NC(NC(=N)N)=N)=CC=C1C
Synonyms:
  • Imidodicarbonimidic diamide N-(4-methyl-3-nitrophenyl)-
  • N-(4-Methyl-3-nitrophenyl)imidodicarbonimidic diamide
  • Imidodicarbonimidic diamide, N-(4-methyl-3-nitrophenyl)-
  • 3-Carbamimidoyl-1-(4-methyl-3-nitrophenyl)guanidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.