CymitQuimica logo

CAS 1379811-71-8

:

Ethyl 3-amino-5-(4-cyclohexylphenyl)-2-thiophenecarboxylate

Description:
Ethyl 3-amino-5-(4-cyclohexylphenyl)-2-thiophenecarboxylate is a chemical compound characterized by its unique structure, which includes a thiophene ring, an ethyl ester group, and an amino group. The presence of the cyclohexylphenyl substituent contributes to its hydrophobic properties, potentially influencing its solubility and reactivity. This compound may exhibit biological activity due to the amino group, which can participate in various chemical interactions, including hydrogen bonding and nucleophilic attacks. The thiophene moiety is known for its electronic properties, which can affect the compound's behavior in organic reactions and its potential applications in materials science or pharmaceuticals. Additionally, the ester functional group can undergo hydrolysis, making it relevant in studies of drug metabolism. Overall, the combination of these functional groups suggests that Ethyl 3-amino-5-(4-cyclohexylphenyl)-2-thiophenecarboxylate could be of interest in medicinal chemistry and organic synthesis, although specific applications would depend on further research and characterization.
Formula:C19H23NO2S
InChI:InChI=1S/C19H23NO2S/c1-2-22-19(21)18-16(20)12-17(23-18)15-10-8-14(9-11-15)13-6-4-3-5-7-13/h8-13H,2-7,20H2,1H3
InChI key:InChIKey=WIXXLVCXJGZXDE-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1SC(=CC1N)C2=CC=C(C=C2)C3CCCCC3
Synonyms:
  • Ethyl 3-amino-5-(4-cyclohexylphenyl)-2-thiophenecarboxylate
  • 2-Thiophenecarboxylic acid, 3-amino-5-(4-cyclohexylphenyl)-, ethyl ester
Found 0 products.