CAS 1379811-96-7

(OC-6-21)-[3-Amino-4-(cyanomethyl)phenyl]pentafluorosulfur

Description:

(OC-6-21)-[3-Amino-4-(cyanomethyl)phenyl]pentafluorosulfur, identified by its CAS number 1379811-96-7, is a specialized chemical compound that features a unique combination of functional groups, including an amino group and a cyanomethyl group attached to a phenyl ring. The presence of pentafluorosulfur indicates that the compound contains a sulfur atom bonded to five fluorine atoms, which contributes to its reactivity and potential applications in various fields, such as materials science and pharmaceuticals. The fluorinated structure often enhances the compound's stability, lipophilicity, and biological activity. Additionally, the cyanomethyl group may impart specific electronic properties, making it useful in synthetic chemistry. Overall, this compound's characteristics suggest it may be of interest for research and development in advanced chemical applications, although detailed studies would be necessary to fully understand its behavior and potential uses.

Formula: C₈H₇F₅N₂S

InChI: InChI=1S/C8H7F5N2S/c9-16(10,11,12,13)7-2-1-6(3-4-14)8(15)5-7/h1-2,5H,3,15H2

InChI key: InChIKey=ZWRCHQXBVCQWHL-UHFFFAOYSA-N

SMILES: S(F)(F)(F)(F)(F)C1=CC(N)=C(CC#N)C=C1

Synonyms:

• Sulfur, [3-amino-4-(cyanomethyl)phenyl]pentafluoro-, (OC-6-21)-
• (OC-6-21)-[3-Amino-4-(cyanomethyl)phenyl]pentafluorosulfur

(2-Amino-4-(pentafluorosulfanyl)phenyl)acetonitrile

CAS: 1379811-96-7

(2-Amino-4-(pentafluorosulfanyl)phenyl)acetonitrile

Purity: ≥95%

Color and Shape: Oil

Molecular weight: 258.21g/mol

Ref: 54-PC405532