CAS 137988-24-0
:Benzoic acid, 4-(cyanomethoxy)-, methyl ester
Description:
Benzoic acid, 4-(cyanomethoxy)-, methyl ester, with the CAS number 137988-24-0, is an organic compound characterized by its ester functional group and the presence of a cyano group. This compound features a benzoic acid backbone, which contributes to its aromatic properties, and a methoxy group that enhances its solubility in organic solvents. The cyano group (-CN) introduces a polar character, making the compound potentially reactive and useful in various chemical syntheses. Typically, esters like this one exhibit moderate volatility and can participate in nucleophilic reactions due to the electrophilic nature of the carbonyl carbon. The presence of both the methoxy and cyano groups may influence its reactivity, stability, and potential applications in pharmaceuticals or agrochemicals. Additionally, the compound's physical properties, such as melting point and boiling point, would be influenced by its molecular structure and intermolecular interactions. Overall, this compound represents a versatile structure in organic chemistry with potential applications in various fields.
Formula:C10H9NO3
InChI:InChI=1S/C10H9NO3/c1-13-10(12)8-2-4-9(5-3-8)14-7-6-11/h2-5H,7H2,1H3
InChI key:InChIKey=ISLSUSBRICMLQB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=C(OCC#N)C=C1
Synonyms:- Methyl 4-(cyanomethoxy)benzoate
- Benzoic acid, 4-(cyanomethoxy)-, methyl ester
- [4-(Methoxycarbonyl)phenoxy]acetonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 4-(cyanomethoxy)benzoate
CAS:<p>Methyl 4-(cyanomethoxy)benzoate</p>Purity:≥95%Molecular weight:191.18g/molMethyl 4-(cyanomethoxy)benzoate
CAS:<p>Methyl 4-(cyanomethoxy)benzoate is a ligand that has been shown to bind to the active site of enzymes such as x-ray, transition, and azide. It has been used in analyses of x-ray diffraction, fluorescent analysis, and hydrothermal synthesis. The tetrazole ring is a key component in the cycloaddition reaction and can be used for the synthesis of coordination polymers. Methyl 4-(cyanomethoxy)benzoate has also been shown to have emission properties.</p>Formula:C10H9NO3Purity:Min. 95%Molecular weight:191.18 g/mol


