CAS 138-59-0: Shikimic acid
Description:Shikimic acid is an organic compound classified as a bicyclic aromatic compound, primarily known for its role in the shikimic acid pathway, which is crucial for the biosynthesis of aromatic amino acids in plants and microorganisms. It is a white crystalline solid that is soluble in water and exhibits a slightly acidic nature due to the presence of multiple hydroxyl groups and a carboxylic acid functional group. The molecular formula of shikimic acid is C7H10O5, and it has a molar mass of approximately 174.16 g/mol. This compound is notable for its use in the production of the antiviral drug oseltamivir (Tamiflu), which is employed in the treatment of influenza. Additionally, shikimic acid has been studied for its potential antioxidant and anti-inflammatory properties. Its natural occurrence is primarily in certain plants, particularly in the star anise fruit, which is a significant source for commercial extraction. Overall, shikimic acid plays an important role in both biochemistry and pharmacology.
Formula:C7H10O5
InChI:InChI=1S/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12)/t4-,5-,6-/m1/s1
InChI key:InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-N
SMILES:O=C(O)C1=CC(O)C(O)C(O)C1
- Synonyms:
- (3R,4S,5R)-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid
- (3R,4S,5R)-3,4,5-Trihydroxycyclohex-1-encarbonsaure
- (3R,4S,5R)-3,4,5-trihydroxycyclohex-1-ene-1-carboxylate
- (3R,4S,5R)-3,4,5-trihydroxycyclohex-1-ene-1-carboxylic acid
- (3R,4S,5R)-3,4,5-trihydroxycyclohex-1-enecarboxylic acid
- 1-Cyclohexene-1-carboxylic acid, 3,4,5-trihydroxy-, (3R,4S,5R)-
- 1-Cyclohexene-1-carboxylic acid, 3,4,5-trihydroxy-, [3R-(3α,4α,5β)]-
- 3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid
- 3,4,5-Trihydroxycyclohex-1-Ene-1-Carboxylic Acid
- <span class="text-smallcaps">L</span>-Shikimic acid
- See more synonyms
- L-Shikimic acid
- Nsc 59257
- Shikimicacid
- [3R-(3α,4α,5β)]-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid
- acide (3R,4S,5R)-3,4,5-trihydroxycyclohex-1-enecarboxylique
- acido (3R,4S,5R)-3,4,5-trihidroxiciclohex-1-enocarboxilico
- Shikimic acid
