CAS 138008-97-6

2-ISOPROPOXYPHENYLBORONIC ACID

Description:

2-Isopropoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with an isopropoxy group. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible complexes with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The isopropoxy group enhances its solubility in organic solvents and may influence its reactivity and stability. 2-Isopropoxyphenylboronic acid is often utilized in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, its boronic acid moiety can participate in the formation of boronate esters, further expanding its utility in synthetic pathways. The compound is generally handled with care due to the potential reactivity of boronic acids, particularly in the presence of moisture, which can lead to hydrolysis. Overall, 2-isopropoxyphenylboronic acid is a versatile reagent in the field of organic chemistry.

Formula: C₉H₁₃BO₃

InChI: InChI=1/C9H13BO3/c1-7(2)13-9-6-4-3-5-8(9)10(11)12/h3-7,11-12H,1-2H3

SMILES: CC(C)Oc1ccccc1B(O)O

Synonyms:

• 2-Isopropoxybenzeneboronic Acid
• Akos Brn-0366
• 2-Isopropoxybenzeneboronic acid 95%
• [2-(1-Methylethoxy)Phenyl]Boronic Acid

Boronic acid, B-[2-(1-methylethoxy)phenyl]-

CAS: 138008-97-6

Formula: C₉H₁₃BO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 180.0087

Ref: IN-DA0017TK

2-Isopropoxybenzeneboronic acid

CAS: 138008-97-6

2-Isopropoxybenzeneboronic acid

Purity: 99%

Molecular weight: 180.01g/mol

Ref: 54-OR3944

2-Isopropoxyphenylboronic acid

CAS: 138008-97-6

Formula: C₉H₁₃BO₃

Purity: 95%

Color and Shape: Liquid, Viscous

Molecular weight: 180.01

Ref: 10-F225443