CAS 138022-00-1

N,N-Dimethyl-1-piperidin-4-ylmethanamine

Description:

N,N-Dimethyl-1-piperidin-4-ylmethanamine, with the CAS number 138022-00-1, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features two methyl groups attached to the nitrogen atom, contributing to its dimethyl designation. It is typically classified as an amine due to the presence of the amine functional group (-NH). The presence of the piperidine ring imparts certain properties, such as potential basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. N,N-Dimethyl-1-piperidin-4-ylmethanamine may exhibit biological activity, making it of interest in pharmaceutical research and development. Its molecular structure suggests it could interact with various biological targets, potentially influencing neurotransmitter systems. As with many amines, it may have a characteristic odor and can be sensitive to air and moisture, necessitating careful handling and storage conditions.

Formula: C₈H₁₈N₂

InChI: InChI=1/C8H18N2/c1-10(2)7-8-3-5-9-6-4-8/h8-9H,3-7H2,1-2H3

SMILES: CN(C)CC1CCNCC1

Synonyms:

• N,N-Dimethyl-1-piperidin-4-ylmethylamine

4-Piperidinemethanamine, N,N-dimethyl-

CAS: 138022-00-1

Formula: C₈H₁₈N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 142.2419

Ref: IN-DA0017UM

4-[(Dimethylamino)methyl]piperidine

CAS: 138022-00-1

4-[(Dimethylamino)methyl]piperidine

Purity: 95%

Color and Shape: Solid

Molecular weight: 142.24192g/mol

Ref: 54-OR5900

N,N-Dimethyl-1-piperidin-4-ylmethanamine

CAS: 138022-00-1

Formula: C₈H₁₈N₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 142.246

Ref: 10-F041897