CAS 1380300-27-5

2H-Pyran-4-amine, tetrahydro-4-(2-methoxyphenyl)-, hydrochloride (1:1)

Description:

2H-Pyran-4-amine, tetrahydro-4-(2-methoxyphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyran ring structure, which is a six-membered heterocyclic compound containing one oxygen atom. The presence of an amine group indicates potential basic properties and reactivity, particularly in forming salts, as evidenced by its hydrochloride form. The tetrahydro configuration suggests that the compound is saturated, contributing to its stability and solubility in polar solvents. The 2-methoxyphenyl substituent introduces an aromatic character, which can influence the compound's electronic properties and interactions with biological targets. This compound may exhibit pharmacological activity, making it of interest in medicinal chemistry. Its hydrochloride salt form enhances solubility and bioavailability, which is crucial for therapeutic applications. Overall, the structural features of this compound suggest it may have diverse applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways.

Formula: C₁₂H₁₇NO₂·ClH

InChI: InChI=1S/C12H17NO2.ClH/c1-14-11-5-3-2-4-10(11)12(13)6-8-15-9-7-12;/h2-5H,6-9,13H2,1H3;1H

InChI key: InChIKey=VBKJVAIYQULSFT-UHFFFAOYSA-N

SMILES: NC1(CCOCC1)C2=C(OC)C=CC=C2.Cl

Synonyms:

• 2H-Pyran-4-amine, tetrahydro-4-(2-methoxyphenyl)-, hydrochloride (1:1)

4-(2-Methoxyphenyl)oxan-4-amine hydrochloride

CAS: 1380300-27-5

Versatile small molecule scaffold

Formula: C₁₂H₁₈ClNO₂

Purity: Min. 95%

Molecular weight: 243.73 g/mol

Ref: 3D-FFC30027