CymitQuimica logo

CAS 1380300-32-2

:

Ethyl 3-(tetrahydro-2H-pyran-4-yl)-1,2,4-oxadiazole-5-carboxylate

Description:
Ethyl 3-(tetrahydro-2H-pyran-4-yl)-1,2,4-oxadiazole-5-carboxylate is a chemical compound characterized by its unique structure, which includes an oxadiazole ring and a tetrahydro-pyran moiety. This compound typically exhibits properties associated with both heterocyclic compounds and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The oxadiazole ring contributes to its stability and may impart biological activity, making it of interest in pharmaceutical research. The ethyl ester group can influence its lipophilicity, affecting its absorption and distribution in biological systems. Additionally, the tetrahydro-pyran component may enhance its structural diversity and potential interactions with biological targets. Overall, this compound's characteristics suggest it could be valuable in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise values.
Formula:C10H14N2O4
InChI:InChI=1S/C10H14N2O4/c1-2-15-10(13)9-11-8(12-16-9)7-3-5-14-6-4-7/h7H,2-6H2,1H3
InChI key:InChIKey=VNDOCNPFDGWPDN-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=NC(=NO1)C2CCOCC2
Synonyms:
  • 1,2,4-Oxadiazole-5-carboxylic acid, 3-(tetrahydro-2H-pyran-4-yl)-, ethyl ester
  • Ethyl 3-(tetrahydro-2H-pyran-4-yl)-1,2,4-oxadiazole-5-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.