CAS 1380300-36-6: 4-(Cyclobutylmethoxy)-3,5-difluorobenzoic acid

Description:4-(Cyclobutylmethoxy)-3,5-difluorobenzoic acid is an organic compound characterized by its unique molecular structure, which includes a benzoic acid core substituted with both cyclobutylmethoxy and difluoro groups. The presence of the cyclobutyl group introduces a cyclic aliphatic structure that can influence the compound's steric and electronic properties. The difluoro substitutions on the benzene ring enhance the compound's lipophilicity and may affect its reactivity and interaction with biological targets. As a benzoic acid derivative, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The compound's specific functional groups suggest potential applications in pharmaceuticals or agrochemicals, where fluorinated compounds are often valued for their enhanced biological activity and stability. Additionally, the presence of the methoxy group can influence solubility and reactivity, making this compound of interest in synthetic organic chemistry and material science. Overall, its unique structural features contribute to its potential utility in various chemical applications.

Formula:C₁₂H₁₂F₂O₃

InChI:InChI=1S/C12H12F2O3/c13-9-4-8(12(15)16)5-10(14)11(9)17-6-7-2-1-3-7/h4-5,7H,1-3,6H2,(H,15,16)

InChI key:InChIKey=GMMQSBUSMMWBSS-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC(F)=C(OCC2CCC2)C(F)=C1

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	4-(Cyclobutylmethoxy)-3,5-difluorobenzoic acid REF: 10-F091301CAS: 1380300-36-6	- - -	To inquire	Mon 24 Mar 25
	4-(Cyclobutylmethoxy)-3,5-difluorobenzoic acid REF: 3D-FFC30036CAS: 1380300-36-6	Min. 95%	- - -	Discontinued product