CAS 1380300-41-3

1,1-Dimethylethyl 3-(2-pyrazinylamino)-1-azetidinecarboxylate

Description:

1,1-Dimethylethyl 3-(2-pyrazinylamino)-1-azetidinecarboxylate, identified by its CAS number 1380300-41-3, is a chemical compound characterized by its unique structural features. It contains an azetidine ring, which is a four-membered saturated heterocyclic structure, and is substituted with a dimethyl group and a pyrazinylamino group. The presence of the pyrazine moiety suggests potential biological activity, as pyrazine derivatives are often associated with various pharmacological properties. The ester functional group in the compound indicates that it may participate in reactions typical of esters, such as hydrolysis or transesterification. Additionally, the steric hindrance introduced by the tert-butyl group (1,1-dimethylethyl) may influence the compound's reactivity and solubility. Overall, this compound's structural complexity and functional groups suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific properties such as solubility, melting point, and biological activity would require empirical data for a comprehensive understanding.

Formula: C₁₂H₁₈N₄O₂

InChI: InChI=1S/C12H18N4O2/c1-12(2,3)18-11(17)16-7-9(8-16)15-10-6-13-4-5-14-10/h4-6,9H,7-8H2,1-3H3,(H,14,15)

InChI key: InChIKey=GEZQBQFLOVYYKS-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(NC=2C=NC=CN2)C1

Synonyms:

• 1-Azetidinecarboxylic acid, 3-(2-pyrazinylamino)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-(2-pyrazinylamino)-1-azetidinecarboxylate

tert-Butyl 3-(pyrazin-2-ylamino)azetidine-1-carboxylate

CAS: 1380300-41-3

Formula: C₁₂H₁₈N₄O₂

Molecular weight: 250.302

Ref: 10-F091312