CAS 1380300-42-4

3-Pyridinemethanamine, 5-chloro-, hydrochloride (1:2)

Description:

3-Pyridinemethanamine, 5-chloro-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chlorinated substituent at the 5-position of the pyridine ring contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. This compound may exhibit properties such as basicity due to the amine functional group, allowing it to participate in protonation reactions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 3-Pyridinemethanamine, 5-chloro-, hydrochloride (1:2) is a compound with significant implications in research and development, particularly in the fields of organic synthesis and drug discovery.

Formula: C₆H₇ClN₂·2ClH

InChI: InChI=1S/C6H7ClN2.2ClH/c7-6-1-5(2-8)3-9-4-6;;/h1,3-4H,2,8H2;2*1H

InChI key: InChIKey=OKMPCMOEKBVLIC-UHFFFAOYSA-N

SMILES: C(N)C=1C=C(Cl)C=NC1.Cl

Synonyms:

• 3-Pyridinemethanamine, 5-chloro-, hydrochloride (1:2)

1-(5-Chloropyridin-3-yl)methanamine dihydrochloride

CAS: 1380300-42-4

Versatile small molecule scaffold

Formula: C₆H₉Cl₃N₂

Purity: Min. 95%

Molecular weight: 215.5 g/mol

Ref: 3D-FFC30042