CAS 1380300-65-1
:Ethyl 3-cyclobutyl-1,2,4-oxadiazole-5-carboxylate
Description:
Ethyl 3-cyclobutyl-1,2,4-oxadiazole-5-carboxylate is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity and chemical reactivity. The presence of the cyclobutyl group introduces a cyclic aliphatic structure that can influence the compound's steric and electronic properties. As an ester, it features an ethyl group attached to the carboxylate moiety, which can enhance its solubility in organic solvents. The oxadiazole ring is known for its stability and ability to participate in various chemical reactions, making this compound of interest in medicinal chemistry and material science. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Additionally, the compound may exhibit interesting pharmacological activities, warranting further investigation into its potential applications in drug development or as a chemical intermediate.
Formula:C9H12N2O3
InChI:InChI=1S/C9H12N2O3/c1-2-13-9(12)8-10-7(11-14-8)6-4-3-5-6/h6H,2-5H2,1H3
InChI key:InChIKey=KTIKEYSHNDRWFZ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=NC(=NO1)C2CCC2
Synonyms:- 1,2,4-Oxadiazole-5-carboxylic acid, 3-cyclobutyl-, ethyl ester
- Ethyl 3-cyclobutyl-1,2,4-oxadiazole-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
