CAS 1380300-68-4
:N-3-Azetidinyl-4-quinazolinamine
Description:
N-3-Azetidinyl-4-quinazolinamine is a chemical compound characterized by its unique structural features, which include a quinazolinamine core and an azetidine substituent. Quinazolinamines are known for their potential biological activities, often exhibiting properties such as antimicrobial, anticancer, and anti-inflammatory effects. The presence of the azetidine ring may contribute to the compound's pharmacological profile, potentially influencing its interaction with biological targets. This compound is typically studied in the context of medicinal chemistry, where modifications to its structure can lead to variations in activity and selectivity. Its specific CAS number, 1380300-68-4, allows for precise identification in chemical databases and literature. As with many compounds in this class, understanding its solubility, stability, and reactivity is crucial for applications in drug development and research. Overall, N-3-Azetidinyl-4-quinazolinamine represents a class of compounds that hold promise for therapeutic applications, warranting further investigation into its properties and potential uses.
Formula:C11H12N4
InChI:InChI=1S/C11H12N4/c1-2-4-10-9(3-1)11(14-7-13-10)15-8-5-12-6-8/h1-4,7-8,12H,5-6H2,(H,13,14,15)
InChI key:InChIKey=HONUBIONPLCTDT-UHFFFAOYSA-N
SMILES:N(C=1C2=C(N=CN1)C=CC=C2)C3CNC3
Synonyms:- 4-Quinazolinamine, N-3-azetidinyl-
- N-3-Azetidinyl-4-quinazolinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(Azetidin-3-yl)quinazolin-4-amine
CAS:Formula:C11H12N4Color and Shape:SolidMolecular weight:200.245
