
CAS 1380300-85-5
:2H-Pyran-4-methanamine, tetrahydro-4-[[3-(trifluoromethyl)phenyl]methyl]-, hydrochloride (1:1)
Description:
2H-Pyran-4-methanamine, tetrahydro-4-[[3-(trifluoromethyl)phenyl]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a pyran ring and a trifluoromethyl-substituted phenyl group. The presence of the tetrahydro configuration indicates that the compound has a saturated cyclic structure, contributing to its stability and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals. The trifluoromethyl group is known for imparting unique electronic properties, potentially influencing the compound's biological activity and interaction with other molecules. This compound may exhibit specific pharmacological effects, making it of interest in medicinal chemistry. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its characteristics and potential uses. As with any chemical, proper handling and safety measures should be observed due to the presence of functional groups that may pose risks.
Formula:C14H18F3NO·ClH
InChI:InChI=1S/C14H18F3NO.ClH/c15-14(16,17)12-3-1-2-11(8-12)9-13(10-18)4-6-19-7-5-13;/h1-3,8H,4-7,9-10,18H2;1H
InChI key:InChIKey=AOOATEJOYDOMOP-UHFFFAOYSA-N
SMILES:C(C1(CN)CCOCC1)C2=CC(C(F)(F)F)=CC=C2.Cl
Synonyms:- 2H-Pyran-4-methanamine, tetrahydro-4-[[3-(trifluoromethyl)phenyl]methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(4-[3-(Trifluoromethyl)phenyl]methyloxan-4-yl)methanamine hydrochloride
CAS:Formula:C14H19ClF3NOMolecular weight:309.76
