CAS 1380310-99-5

4-Chloro-7-[(4-fluorophenyl)methyl]-7H-pyrrolo[2,3-d]pyrimidine

Description:

4-Chloro-7-[(4-fluorophenyl)methyl]-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolo[2,3-d]pyrimidine core. This compound features a chloro substituent at the 4-position and a 4-fluorophenylmethyl group at the 7-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of halogen atoms, such as chlorine and fluorine, often enhances the compound's biological activity and lipophilicity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of targeted therapies. Additionally, the compound may exhibit specific reactivity patterns due to the electron-withdrawing effects of the halogens, influencing its interactions with biological targets. As with many heterocycles, it may also display interesting optical and electronic properties, which can be explored for various applications in materials science and drug development.

Formula: C₁₃H₉ClFN₃

InChI: InChI=1S/C13H9ClFN3/c14-12-11-5-6-18(13(11)17-8-16-12)7-9-1-3-10(15)4-2-9/h1-6,8H,7H2

InChI key: InChIKey=ZSDCJBKSWNJZPV-UHFFFAOYSA-N

SMILES: C(N1C=2C(C=C1)=C(Cl)N=CN2)C3=CC=C(F)C=C3

Synonyms:

• 7H-Pyrrolo[2,3-d]pyrimidine, 4-chloro-7-[(4-fluorophenyl)methyl]-
• 4-Chloro-7-[(4-fluorophenyl)methyl]-7H-pyrrolo[2,3-d]pyrimidine

7-(4-FLUOROBENZYL)-4-CHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE

CAS: 1380310-99-5

Formula: C₁₃H₉ClFN₃

Purity: 95.0%

Molecular weight: 261.68

Ref: 10-F334129