CAS 13807-84-6
:2-Phenoxybenzyl alcohol
Description:
2-Phenoxybenzyl alcohol, with the CAS number 13807-84-6, is an organic compound characterized by its phenolic structure. It features a benzyl alcohol moiety attached to a phenoxy group, which contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its moderate solubility in organic solvents and limited solubility in water, which is common for many phenolic compounds. 2-Phenoxybenzyl alcohol exhibits properties such as being a potential intermediate in organic synthesis and may have applications in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, it may possess antioxidant properties due to the presence of the phenolic hydroxyl group. Safety data indicates that, like many organic compounds, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Proper storage and handling protocols are essential to ensure safety and stability.
Formula:C13H12O2
InChI:InChI=1/C13H12O2/c14-10-11-6-4-5-9-13(11)15-12-7-2-1-3-8-12/h1-9,14H,10H2
SMILES:c1ccc(cc1)Oc1ccccc1CO
Synonyms:- (2-Phenoxyphenyl)Methanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzenemethanol, 2-phenoxy-
CAS:Formula:C13H12O2Purity:98%Color and Shape:LiquidMolecular weight:200.23322-Phenoxybenzyl alcohol
CAS:2-Phenoxybenzyl alcoholFormula:C13H12O2Purity:97%Color and Shape: colourless liquidMolecular weight:200.23g/mol2-Phenoxybenzyl alcohol
CAS:2-Phenoxybenzyl alcohol is an active compound that is a diarylamine with a phenoxy group. It has photochemistry activity, which can be used to form methanes and polyhalogenated phenoxy compounds. 2-Phenoxybenzyl alcohol has been found to react with amides and carbonyl groups in nature. This chemical also has the ability to undergo transfer and shift reactions.
Formula:C13H12O2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:200.23 g/mol




