CAS 138090-06-9
:(5R,11R)-5,11-DIETHYL-5,6,11,12-TETRAHYDRO-2,8-CHRYSENEDIOL
Description:
(5R,11R)-5,11-Diethyl-5,6,11,12-tetrahydro-2,8-chrysenediol is a polycyclic aromatic compound characterized by its complex structure, which includes multiple fused rings and hydroxyl functional groups. This compound features a chiral center, indicated by the (5R,11R) configuration, which contributes to its stereochemistry and potential biological activity. The presence of diethyl groups enhances its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The tetrahydro configuration suggests that it is partially saturated, which may affect its reactivity and stability compared to fully aromatic compounds. The hydroxyl groups provide sites for hydrogen bonding, potentially increasing its polarity and reactivity in various chemical environments. This compound may be of interest in medicinal chemistry and materials science due to its unique structural features and potential applications in drug development or as a precursor in organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C22H24O2
InChI:InChI=1/C22H24O2/c1-3-13-9-15-11-17(23)6-8-20(15)22-14(4-2)10-16-12-18(24)5-7-19(16)21(13)22/h5-8,11-14,23-24H,3-4,9-10H2,1-2H3/t13-,14-/m1/s1
SMILES:CC[C@@H]1Cc2cc(ccc2C2=C1c1ccc(cc1C[C@H]2CC)O)O
Synonyms:- (R,R)-Thc
- (R,R)-Cis-Diethyltetrahydro-2,8-Chrysenediol
- (R,R)-5,11-Diethyl-5,6,11,12-Tetrahydro-2,8-Chrysenediol
- (5R,11R)-5,11-diethyl-5,6,11,12-tetrahydrochrysene-2,8-diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
cis-5,11-Diethyl-5,6,11,12-tetrahydro-2,8-chrysenediol
CAS:Controlled ProductApplications cis-5,11-Diethyl-5,6,11,12-tetrahydro-2,8-chrysenediol is a fluorescent and selective ligand that can be used to investigate the interactions between ligand and receptor of estrogen receptors (ERs) (1,2,3). cis-5,11-Diethyl-5,6,11,12-tetrahydro-2,8-chrysenediol is an ERα agonist and an ERβ antagonist.
References (1) Sumbayev, V. V., et al.: Mol Cell Endocrinol 287, 30 (2008) (2) Rosado, J., et al.: Biochem. J., 350, 631 (2000) (3) Dobrydneva, Y., et al.: J. Cardiovasc. Pharmacol., 40, 399 (2002)Formula:C22H24O2Color and Shape:NeatMolecular weight:320.42(R,R)-THC
CAS:agonist at ERα receptor and antagonist at ERβ receptorFormula:C22H24O2Purity:98%Color and Shape:SolidMolecular weight:320.42

