CAS 138109-65-6
:L-PENTAFLUOROPHE
Description:
L-Pentafluorophenyl is a chemical compound characterized by the presence of five fluorine atoms attached to a phenyl ring. This substitution significantly enhances its electronegativity and lipophilicity, making it a highly reactive and stable compound under various conditions. The presence of multiple fluorine atoms contributes to its unique properties, such as increased thermal stability and resistance to oxidation. L-Pentafluorophenyl is often utilized in various applications, including pharmaceuticals, agrochemicals, and materials science, due to its ability to modify the electronic properties of molecules. Its high fluorine content can also impart desirable characteristics in terms of solubility and volatility. However, handling this compound requires caution due to its potential environmental impact and toxicity. Overall, L-pentafluorophenyl serves as an important building block in synthetic chemistry, enabling the development of advanced materials and compounds with tailored properties.
Formula:C9H6F5NO2
InChI:InChI=1/C9H6F5NO2/c10-4-2(1-3(15)9(16)17)5(11)7(13)8(14)6(4)12/h3H,1,15H2,(H,16,17)/t3-/m1/s1
SMILES:C(c1c(c(c(c(c1F)F)F)F)F)[C@H](C(=O)O)N
Synonyms:- (S)-2-Amino-3-Pentafluorophenyl-Propionic Acid
- Rarechem Bk Pt 0103
- Pentafluoro-L-Phenylalanine
- L-Pentafluorophenylalanine
- H-Phe(F5)-Oh
- H-Pentafluoro-Phe-Oh
- 2,3,4,5,6-pentafluoro-L-phenylalanine
- (2R)-2-ammonio-3-(pentafluorophenyl)propanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
