CAS 13811-50-2
:N,N′-Divinylethyleneurea
Description:
N,N′-Divinylethyleneurea is a chemical compound characterized by its dual vinyl groups attached to an ethyleneurea backbone. This structure allows it to participate in various polymerization reactions, making it useful as a monomer in the synthesis of polymers and copolymers. The compound is typically a colorless to pale yellow liquid with a relatively low viscosity, and it has a distinctive odor. It is soluble in organic solvents but has limited solubility in water. N,N′-Divinylethyleneurea is known for its ability to undergo free radical polymerization, which can lead to the formation of cross-linked networks, enhancing the mechanical properties of the resulting materials. Additionally, it exhibits thermal stability, making it suitable for applications in coatings, adhesives, and sealants. However, like many vinyl compounds, it may pose health risks if inhaled or ingested, necessitating proper handling and safety precautions during its use in industrial and laboratory settings.
Formula:C7H10N2O
InChI:InChI=1S/C7H10N2O/c1-3-8-5-6-9(4-2)7(8)10/h3-4H,1-2,5-6H2
InChI key:InChIKey=HMYBDZFSXBJDGL-UHFFFAOYSA-N
SMILES:C(=C)N1C(=O)N(C=C)CC1
Synonyms:- 1,3-Diethenylimidazolidin-2-One
- 1,3-Diethynylimidazolidin-2-one
- 1,3-Divinylimidazolid-2-one
- 1,3-Divinylimidazolidin-2-one
- 1,3-diethenyl-2-Imidazolidinone
- 2-Imidazolidinone, 1,3-diethenyl-
- 2-Imidazolidinone, 1,3-diethynyl-
- 2-Imidazolidinone, 1,3-divinyl-
- N,N′-Divinyl-2-imidazolidinone
- N,N′-Divinylethyleneurea
- N,N′-Divinylimidazolidone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

