CAS 13813-19-9
:Sulfuric acid-d2
Description:
Sulfuric acid-d2, also known as deuterated sulfuric acid, is a heavy isotope-labeled form of sulfuric acid where the hydrogen atoms are replaced with deuterium, a stable isotope of hydrogen. This compound retains the fundamental properties of sulfuric acid, which is a colorless, viscous liquid known for its strong acidic nature and high reactivity. Sulfuric acid-d2 is primarily used in research applications, particularly in studies involving nuclear magnetic resonance (NMR) spectroscopy, where the presence of deuterium can provide insights into molecular structures and dynamics. The deuteration can also influence reaction kinetics and mechanisms in chemical processes. Like its non-deuterated counterpart, sulfuric acid-d2 is highly corrosive and can cause severe chemical burns, necessitating careful handling and appropriate safety measures. It is soluble in water and can release heat upon dilution. Overall, sulfuric acid-d2 serves as a valuable tool in various scientific investigations while maintaining the essential characteristics of sulfuric acid.
Formula:D2O4S
InChI:InChI=1S/H2O4S/c1-5(2,3)4/h(H2,1,2,3,4)/i/hD2
InChI key:InChIKey=QAOWNCQODCNURD-ZSJDYOACSA-N
SMILES:S(=O)(=O)(O[2H])O[2H]
Synonyms:- (~2~H_2_)sulfuric acid
- Deuterated Sulfuric Acid
- Deuterosulfuric acid
- Perdeuterated sulfuric acid
- Perdeuteriosulfuric acid
- Sulfuric acid (D<sub>2</sub>SO<sub>4</sub>)
- Sulfuric acid-d<sub>2</sub>
- Sulfuricacid
- Sulfuric acid-d2
- Sulfuric acid (D2SO4)
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Deuterosulfuric acid, 96% min in D{2}O, 99.5% (Isotopic)
CAS:Deuterated sulfuric acid when treated with benzene, the deuterium is used in order to observe the reaction course by NMR spectroscopy, deuterated sulfuric acid results in an electrophilic aromatic substitution of hydrogen by deuterium. This Thermo Scientific Chemicals brand product was originally paFormula:H2O4SPurity:99.5%Molecular weight:100.08Sulfuric Acid-d2(96% w/w in D2O)
CAS:Controlled ProductFormula:D2SO4D2OsolutionPurity:99 atom % DColor and Shape:Colorless LiquidMolecular weight:100.09



