CAS 138147-78-1
:N~2~-[(3R)-2,3,4,9-tetrahydro-1H-beta-carbolin-3-ylcarbonyl]-L-glutaminyl-L-tryptophylalanyl-L-valylglycyl-N-(1-{[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino}-4-methylpentan-2-yl)-L-histidinamide
Description:
The chemical substance with the name "N~2~-[(3R)-2,3,4,9-tetrahydro-1H-beta-carbolin-3-ylcarbonyl]-L-glutaminyl-L-tryptophylalanyl-L-valylglycyl-N-(1-{[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino}-4-methylpentan-2-yl)-L-histidinamide" and CAS number "138147-78-1" is a complex peptide derivative characterized by its intricate structure, which includes multiple amino acid residues and a beta-carboline moiety. This compound exhibits properties typical of peptides, such as potential bioactivity and specificity in biological interactions. The presence of various amino acids suggests it may play a role in biological processes, possibly as a signaling molecule or in therapeutic applications. Its beta-carboline component may also indicate potential neuroactive properties, as beta-carbolines are known for their interactions with neurotransmitter systems. The compound's solubility, stability, and reactivity would depend on its specific functional groups and the overall conformation, which can influence its biological activity and pharmacokinetics. Further studies would be necessary to elucidate its precise mechanisms of action and potential applications in medicinal chemistry.
Formula:C56H79N15O9
InChI:InChI=1/C56H79N15O9/c1-29(2)18-35(25-61-42(50(58)74)19-30(3)4)66-55(79)45(21-34-24-59-28-64-34)68-48(73)27-63-56(80)49(31(5)6)71-51(75)32(7)65-54(78)44(20-33-23-60-39-14-10-8-12-36(33)39)70-52(76)41(16-17-47(57)72)69-53(77)43-22-38-37-13-9-11-15-40(37)67-46(38)26-62-43/h8-15,23-24,28-32,35,41-45,49,60-62,67H,16-22,25-27H2,1-7H3,(H2,57,72)(H2,58,74)(H,59,64)(H,63,80)(H,65,78)(H,66,79)(H,68,73)(H,69,77)(H,70,76)(H,71,75)/t32?,35?,41-,42-,43+,44-,45-,49-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
RC-3095
CAS:RC-3095, a selective GRPR antagonist, has been shown to have anti-inflammatory properties in different models of inflammation.Formula:C56H79N15O9Purity:98%Color and Shape:SolidMolecular weight:1106.32RC-3095
CAS:RC-3095 is a guanine nucleotide-binding protein (G protein) antagonist that inhibits the activation of Toll-like receptor 4 (TLR4). It has been shown to reduce oxidative injury and improve locomotor activity in an experimental model. RC-3095 also has anti-inflammatory effects, which may be due to its ability to inhibit the activity of matrix metalloproteinase 9, as well as its ability to modulate toll-like receptor signaling. RC-3095 also binds to polymerase chain reaction amplicons, allowing for the development of a new analytical method for screening and confirming the presence of mutations in genes associated with chronic arthritis.Formula:C58H80F3N15O11Purity:Min. 95%Molecular weight:1,220.3 g/mol

