CAS 13817-79-3

[4-(4-phosphonophenyl)phenyl]phosphonic acid

Description:

[4-(4-Phosphonophenyl)phenyl]phosphonic acid, with the CAS number 13817-79-3, is an organophosphorus compound characterized by its phosphonic acid functional group, which imparts significant acidity and reactivity. This compound features a biphenyl structure, where one of the phenyl rings is substituted with a phosphonophenyl group, enhancing its potential for coordination with metal ions and its utility in various chemical applications. It is typically a white to off-white solid and is soluble in polar solvents, making it suitable for use in aqueous environments. The presence of phosphonic acid groups allows for strong interactions with biological molecules, which can be advantageous in fields such as biochemistry and materials science. Additionally, this compound may exhibit properties such as chelation and adsorption, making it relevant in catalysis, water treatment, and as a potential agent in drug delivery systems. Its unique structural features and functional groups contribute to its versatility in both industrial and research applications.

Formula: C₁₂H₁₂O₆P₂

InChI: InChI=1/C12H12O6P2/c13-19(14,15)11-5-1-9(2-6-11)10-3-7-12(8-4-10)20(16,17)18/h1-8H,(H2,13,14,15)(H2,16,17,18)

SMILES: c1cc(ccc1c1ccc(cc1)P(=O)(O)O)P(=O)(O)O

Synonyms:

• Biphenyl-4,4'-diylbis(phosphonic acid)
• Phosphonic Acid, [1,1'-Biphenyl]-4,4'-Diylbis-

Phosphonic acid, P,P'-[1,1'-biphenyl]-4,4'-diylbis-

CAS: 13817-79-3

Formula: C₁₂H₁₂O₆P₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 314.1676

Ref: IN-DA00184B

[1,1'-Biphenyl]-4,4'-diylbis(phosphonic acid)

CAS: 13817-79-3

[1,1'-Biphenyl]-4,4'-diylbis(phosphonic acid)

Purity: 98%

Molecular weight: 314.17g/mol

Ref: 54-OR1005308

[1,1′-Biphenyl]-4,4′-diylbis(phosphonic acid)

CAS: 13817-79-3

Purity: 98%

Molecular weight: 314.1700134

Ref: 10-F624437