CymitQuimica logo

CAS 1381861-96-6

:

14-(2-Hydroxytridecyl)-17,20-dioxa-14,23-diazahexatriacontane-12,25-diol

Description:
The chemical substance known as "14-(2-Hydroxytridecyl)-17,20-dioxa-14,23-diazahexatriacontane-12,25-diol," with the CAS number 1381861-96-6, is a complex organic compound characterized by its long carbon chain and multiple functional groups. It features a polyamine structure, which includes nitrogen atoms that can participate in hydrogen bonding and coordination with metal ions. The presence of hydroxyl groups contributes to its hydrophilicity, enhancing solubility in polar solvents and potentially influencing its biological activity. The dioxa and diaza components suggest that the molecule may exhibit unique properties related to its ability to form chelates or interact with biological systems. Its long hydrocarbon chain may also impart lipophilic characteristics, allowing it to interact with lipid membranes. Overall, this compound's structural complexity indicates potential applications in fields such as pharmaceuticals, materials science, or biochemistry, where its unique properties could be harnessed for specific functions or interactions. Further studies would be necessary to elucidate its precise behavior and applications.
Formula:C45H94N2O5
InChI:InChI=1S/C45H94N2O5/c1-4-7-10-13-16-19-22-25-28-31-43(48)40-46-34-36-51-38-39-52-37-35-47(41-44(49)32-29-26-23-20-17-14-11-8-5-2)42-45(50)33-30-27-24-21-18-15-12-9-6-3/h43-46,48-50H,4-42H2,1-3H3
InChI key:InChIKey=SFPCEMORTGPRFG-UHFFFAOYSA-N
SMILES:N(CC(CCCCCCCCCCC)O)(CC(CCCCCCCCCCC)O)CCOCCOCCNCC(CCCCCCCCCCC)O
Synonyms:
  • 14-(2-Hydroxytridecyl)-17,20-dioxa-14,23-diazahexatriacontane-12,25-diol
  • 17,20-Dioxa-14,23-diazahexatriacontane-12,25-diol, 14-(2-hydroxytridecyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.