CymitQuimica logo

CAS 1381944-28-0

:

2-Fluoro-4′-methoxy[1,1′-biphenyl]-3-carboxylic acid

Description:
2-Fluoro-4′-methoxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 2-position and a methoxy group at the 4′-position on one of the phenyl rings contributes to its unique chemical properties, including potential variations in polarity and reactivity. The carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular interactions can be influenced by the electron-withdrawing nature of the fluoro group and the electron-donating characteristics of the methoxy group. Additionally, the compound's stability, melting point, and solubility can vary based on environmental conditions and the presence of other chemical species. Overall, 2-Fluoro-4′-methoxy[1,1′-biphenyl]-3-carboxylic acid represents a versatile structure for further exploration in various chemical and pharmaceutical applications.
Formula:C14H11FO3
InChI:InChI=1S/C14H11FO3/c1-18-10-7-5-9(6-8-10)11-3-2-4-12(13(11)15)14(16)17/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=QTWAXSYIEXLMIS-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1C(O)=O)C2=CC=C(OC)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 2-fluoro-4′-methoxy-
  • 2-Fluoro-4′-methoxy[1,1′-biphenyl]-3-carboxylic acid
Found 1 products.