CymitQuimica logo

CAS 1381944-46-2

:

Methyl 2,4′-difluoro-3′-methoxy[1,1′-biphenyl]-3-carboxylate

Description:
Methyl 2,4′-difluoro-3′-methoxy[1,1′-biphenyl]-3-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2 and 4' positions of the biphenyl moiety contributes to its unique electronic properties and potential reactivity. The methoxy group at the 3' position enhances its solubility in organic solvents and may influence its biological activity. Additionally, the carboxylate functional group, derived from the carboxylic acid, indicates that this compound can participate in various chemical reactions, such as esterification or nucleophilic substitution. The methyl ester form suggests that it may be used in synthetic applications or as an intermediate in the production of more complex molecules. Overall, this compound's specific functional groups and structural features make it of interest in fields such as medicinal chemistry and materials science, where fluorinated compounds often exhibit enhanced properties.
Formula:C15H12F2O3
InChI:InChI=1S/C15H12F2O3/c1-19-13-8-9(6-7-12(13)16)10-4-3-5-11(14(10)17)15(18)20-2/h3-8H,1-2H3
InChI key:InChIKey=HVAVCEGCGIXFDJ-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1C(OC)=O)C2=CC(OC)=C(F)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 2,4′-difluoro-3′-methoxy-, methyl ester
  • Methyl 2,4′-difluoro-3′-methoxy[1,1′-biphenyl]-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.