CAS 1381944-75-7: Phenylmethyl N-(4′-cyano-3′-fluoro[1,1′-biphenyl]-4-yl)carbamate

Description:Phenylmethyl N-(4′-cyano-3′-fluoro[1,1′-biphenyl]-4-yl)carbamate, identified by its CAS number 1381944-75-7, is a synthetic organic compound characterized by its complex structure, which includes a carbamate functional group and a biphenyl moiety with cyano and fluoro substituents. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for π-π stacking interactions due to its biphenyl structure. The presence of the cyano group may impart polar characteristics, while the fluoro substituent can enhance lipophilicity and influence the compound's reactivity and solubility in various solvents. Its unique combination of functional groups suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. As with many synthetic organic compounds, safety and handling precautions are essential, given the potential toxicity associated with certain functional groups. Further studies would be necessary to fully elucidate its physical and chemical properties, as well as its biological activity.

Formula:C₂₁H₁₅FN₂O₂

InChI:InChI=1S/C21H15FN2O2/c22-20-12-17(6-7-18(20)13-23)16-8-10-19(11-9-16)24-21(25)26-14-15-4-2-1-3-5-15/h1-12H,14H2,(H,24,25)

InChI key:InChIKey=GXVLLWPSFPWDHT-UHFFFAOYSA-N

SMILES:N#CC=1C=CC(=CC1F)C2=CC=C(C=C2)NC(=O)OCC=3C=CC=CC3

Synonyms:
Phenylmethyl N-(4′-cyano-3′-fluoro[1,1′-biphenyl]-4-yl)carbamate
Carbamic acid, N-(4′-cyano-3′-fluoro[1,1′-biphenyl]-4-yl)-, phenylmethyl ester

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Carbamic acid, N-(4'-cyano-3'-fluoro[1,1'-biphenyl]-4-yl)-, phenylmethyl ester REF: IN-DA00187LCAS: 1381944-75-7	- - -	To inquire	Wed 26 Mar 25
Benzyl N-[4-(4-cyano-3-fluorophenyl)phenyl]carbamate REF: 10-F638212CAS: 1381944-75-7	95%	- - -	Discontinued product
Benzyl N-[4-(4-cyano-3-fluorophenyl)phenyl]carbamate REF: 3D-GFC94475CAS: 1381944-75-7	Min. 95%	- - -	Discontinued product