CAS 1381944-79-1

2′-Fluoro-5-methoxy[1,1′-biphenyl]-3,4′-dicarboxylic acid

Description:

2′-Fluoro-5-methoxy[1,1′-biphenyl]-3,4′-dicarboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 2' position and a methoxy group at the 5 position on one of the phenyl rings contributes to its unique chemical properties, including potential changes in polarity and reactivity. The dicarboxylic acid functionality indicates the presence of two carboxylic acid groups, which can participate in hydrogen bonding and influence solubility in polar solvents. This compound may exhibit interesting biological activity due to its structural features, making it a candidate for research in medicinal chemistry. Additionally, the presence of both electron-withdrawing (fluoro) and electron-donating (methoxy) groups can affect the electronic distribution within the molecule, potentially impacting its reactivity and interactions with other chemical species. Overall, 2′-Fluoro-5-methoxy[1,1′-biphenyl]-3,4′-dicarboxylic acid presents a diverse range of characteristics that can be explored in various chemical and biological contexts.

Formula: C₁₅H₁₁FO₅

InChI: InChI=1S/C15H11FO5/c1-21-11-5-9(4-10(6-11)15(19)20)12-3-2-8(14(17)18)7-13(12)16/h2-7H,1H3,(H,17,18)(H,19,20)

InChI key: InChIKey=OTLALIDSXJHJRX-UHFFFAOYSA-N

SMILES: FC1=C(C=CC(C(O)=O)=C1)C2=CC(C(O)=O)=CC(OC)=C2

Synonyms:

• 2′-Fluoro-5-methoxy[1,1′-biphenyl]-3,4′-dicarboxylic acid
• [1,1′-Biphenyl]-3,4′-dicarboxylic acid, 2′-fluoro-5-methoxy-

2-Fluoro-5'-methoxybiphenyl-3',4-dicarboxylic acid

CAS: 1381944-79-1

Formula: C₁₅H₁₁FO₅

Molecular weight: 290.2432

Ref: IN-DA00187H