CymitQuimica logo

CAS 1381946-83-3

:

Ethyl 2-amino-4-(dimethylamino)butanoate

Description:
Ethyl 2-amino-4-(dimethylamino)butanoate, with the CAS number 1381946-83-3, is an organic compound characterized by its amino acid-like structure. It features an ethyl ester functional group, which contributes to its solubility in organic solvents. The presence of a dimethylamino group enhances its basicity and potential for forming salts. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in pharmaceuticals, particularly in the synthesis of various bioactive molecules. The amino group allows for participation in various chemical reactions, including acylation and alkylation, making it a versatile intermediate in organic synthesis. Additionally, its structural features suggest that it may exhibit biological activity, although specific pharmacological properties would require further investigation. Safety data should be consulted, as with any chemical, to understand its handling and potential hazards.
Formula:C8H18N2O2
InChI:InChI=1S/C8H18N2O2/c1-4-12-8(11)7(9)5-6-10(2)3/h7H,4-6,9H2,1-3H3
InChI key:InChIKey=ZJJRFRAPHLHVDI-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(CCN(C)C)N
Synonyms:
  • Butanoic acid, 2-amino-4-(dimethylamino)-, ethyl ester
  • Ethyl 2-amino-4-(dimethylamino)butanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.