CAS 1381947-84-7
:Phenylmethyl N-[2-[(2-amino-4-methoxyphenyl)phenylamino]-2-oxoethyl]carbamate
Description:
Phenylmethyl N-[2-[(2-amino-4-methoxyphenyl)phenylamino]-2-oxoethyl]carbamate, identified by its CAS number 1381947-84-7, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple aromatic rings and functional groups. This compound features a carbamate functional group, which is known for its role in various biological activities and potential pharmaceutical applications. The presence of an amino group and a methoxy group on the aromatic rings suggests that it may exhibit specific interactions with biological targets, potentially influencing its solubility and reactivity. Additionally, the compound's structure indicates it may possess properties such as moderate lipophilicity, which can affect its bioavailability and pharmacokinetics. While specific physical properties like melting point, boiling point, and solubility are not detailed here, compounds of this nature often exhibit interesting biological activities, making them subjects of interest in medicinal chemistry and drug development. Further studies would be necessary to fully elucidate its characteristics and potential applications.
Formula:C23H23N3O4
InChI:InChI=1S/C23H23N3O4/c1-29-19-12-13-21(20(24)14-19)26(18-10-6-3-7-11-18)22(27)15-25-23(28)30-16-17-8-4-2-5-9-17/h2-14H,15-16,24H2,1H3,(H,25,28)
InChI key:InChIKey=FWJGSHPPZVKMNT-UHFFFAOYSA-N
SMILES:N(C(CNC(OCC1=CC=CC=C1)=O)=O)(C2=C(N)C=C(OC)C=C2)C3=CC=CC=C3
Synonyms:- Benzyl (2-((2-amino-4-methoxyphenyl)(phenyl)amino)-2-oxoethyl)carbamate
- Carbamic acid, N-[2-[(2-amino-4-methoxyphenyl)phenylamino]-2-oxoethyl]-, phenylmethyl ester
- Phenylmethyl N-[2-[(2-amino-4-methoxyphenyl)phenylamino]-2-oxoethyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzyl (2-((2-amino-4-methoxyphenyl)(phenyl)amino)-2-oxoethyl)carbamate
CAS:Formula:C23H23N3O4Molecular weight:405.4464
