CAS 1381952-86-8

4-[2-Bromo-6-(trifluoromethoxy)phenyl]-3-buten-2-one

Description:

4-[2-Bromo-6-(trifluoromethoxy)phenyl]-3-buten-2-one is an organic compound characterized by its unique molecular structure, which includes a butenone moiety and a brominated phenyl group with a trifluoromethoxy substituent. This compound typically exhibits a yellow to brown appearance and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of the bromine and trifluoromethoxy groups contributes to its reactivity and potential applications in medicinal chemistry and material science. The trifluoromethoxy group, in particular, enhances lipophilicity and may influence biological activity, making it of interest in drug design. Additionally, the compound's structure suggests potential for electrophilic reactions due to the presence of the double bond in the butenone, which can participate in various chemical transformations. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, this compound represents a valuable entity for research and development in various chemical applications.

Formula: C₁₁H₈BrF₃O₂

InChI: InChI=1S/C11H8BrF3O2/c1-7(16)5-6-8-9(12)3-2-4-10(8)17-11(13,14)15/h2-6H,1H3

InChI key: InChIKey=KHRPNNZODGRFMN-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=C(C=CC(C)=O)C(Br)=CC=C1

(3E)-4-[2-Bromo-6-(trifluoromethoxy)phenyl]but-3-en-2-one

CAS: 1381952-86-8

Formula: C₁₁H₈BrF₃O₂

Molecular weight: 309.0792

Ref: IN-DA00188S