CAS 1382107-10-9
:Butyl hydrogen P-acetylphosphonate
Description:
Butyl hydrogen P-acetylphosphonate, identified by its CAS number 1382107-10-9, is an organophosphorus compound characterized by the presence of a butyl group and an acetyl group attached to a phosphonate moiety. This compound typically exhibits properties common to phosphonates, such as being a colorless to pale yellow liquid with a relatively low viscosity. It is soluble in organic solvents and may have limited solubility in water. The presence of the acetyl group suggests that it may participate in various chemical reactions, including esterification and hydrolysis. Butyl hydrogen P-acetylphosphonate may also exhibit biological activity, making it of interest in agricultural and pharmaceutical applications. Its stability and reactivity can be influenced by environmental conditions, such as pH and temperature. As with many organophosphorus compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, this compound represents a versatile structure within the realm of organophosphorus chemistry.
Formula:C6H13O4P
InChI:InChI=1S/C6H13O4P/c1-3-4-5-10-11(8,9)6(2)7/h3-5H2,1-2H3,(H,8,9)
InChI key:InChIKey=JGFBWABEUCASTP-UHFFFAOYSA-N
SMILES:P(OCCCC)(C(C)=O)(=O)O
Synonyms:- Butyl hydrogen P-acetylphosphonate
- Phosphonic acid, P-acetyl-, monobutyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
