CAS 13822-06-5
:3-METHYL-2-BUTEN-1-AMINE
Description:
3-Methyl-2-buten-1-amine, with the CAS number 13822-06-5, is an organic compound characterized by its aliphatic structure featuring both an amine and an alkene functional group. It is a colorless to pale yellow liquid at room temperature and possesses a distinct odor. The compound has a molecular formula that reflects its carbon, hydrogen, and nitrogen content, indicating the presence of a branched chain due to the methyl group. Its unsaturation, due to the double bond between the second and third carbon atoms, contributes to its reactivity, making it a potential candidate for various chemical reactions, including polymerization and addition reactions. The amine group imparts basic properties, allowing it to participate in nucleophilic reactions. 3-Methyl-2-buten-1-amine is used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Safety data should be consulted for handling, as amines can be irritants and may pose health risks upon exposure.
Formula:C5H11N
InChI:InChI=1/C5H11N/c1-5(2)3-4-6/h3H,4,6H2,1-2H3
SMILES:CC(=CCN)C
Synonyms:- 3-Methyl-But-2-Enylamine
- 3-Methyl-2-butylene-1-amine
- 3-Methylbut-2-En-1-Amine
- gamma,gamma-Dimethylallylamine
- 3-Methyl-2-butenylamine
- 2-Buten-1-amine, 3-methyl-
- 1-Amino-3-methyl-2-butene
- 3,3-Dimethylallylamine
- 3-METHYL-2-BUTEN-1-AMINE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Buten-1-amine, 3-methyl-
CAS:Formula:C5H11NPurity:95%Color and Shape:LiquidMolecular weight:85.14753-Methyl-2-buten-1-amine
CAS:3-Methyl-2-buten-1-amine is a chemical compound that contains an amine group, a carboxylic acid group, and a double bond. It can be synthesized by the reaction of 6-chloropurine with allylamine in the presence of carbonation. 3-Methyl-2-buten-1-amine has been used in the synthesis of adenosine and pyrrolidinone. This compound also possesses physiological activities such as being able to cause parthenocarpy in plants. 3-Methyl-2-buten-1-amine cyclizes to form purines, which are nitrogenous bases found in DNA and RNA molecules.Formula:C5H11NPurity:Min. 98 Area-%Color and Shape:Clear LiquidMolecular weight:85.15 g/mol



