CAS 138220-00-5
:bombinin-like peptide-1
Description:
Bombinin-like peptide-1 (BLP-1) is a bioactive peptide derived from the skin secretions of certain amphibians, particularly the Bombina species. It is characterized by its antimicrobial and cytotoxic properties, making it a subject of interest in biomedical research. BLP-1 typically consists of a sequence of amino acids that contribute to its ability to disrupt microbial membranes, thereby exhibiting potent antimicrobial activity against a range of pathogens, including bacteria and fungi. Additionally, this peptide has been studied for its potential roles in immune response modulation and as a candidate for developing new therapeutic agents. Its structure often includes a cationic nature, which is crucial for its interaction with negatively charged microbial membranes. The peptide's stability and activity can be influenced by factors such as pH and ionic strength, which are important considerations in its application in drug development and therapeutic contexts. Overall, BLP-1 represents a promising area of research in the field of antimicrobial peptides and their potential applications in medicine.
Formula:C115H194N34O33
InChI:InChI=1/C115H194N34O33/c1-19-61(11)92(147-86(154)47-119)114(181)126-49-87(155)128-64(14)95(162)144-84(55-152)113(180)148-93(62(12)20-2)115(182)143-78(43-60(9)10)108(175)146-83(54-151)111(178)129-63(13)94(161)123-50-88(156)134-74(34-26-29-39-118)103(170)145-82(53-150)112(179)133-67(17)97(164)139-77(42-59(7)8)107(174)138-73(33-25-28-38-117)102(169)125-52-90(158)135-75(40-57(3)4)104(171)130-65(15)96(163)137-72(32-24-27-37-116)101(168)124-51-89(157)136-76(41-58(5)6)105(172)132-68(18)99(166)149-110(177)81(46-91(159)160)140-98(165)66(16)131-106(173)79(44-69-30-22-21-23-31-69)142-109(176)80(45-70-48-122-56-127-70)141-100(167)71(120)35-36-85(121)153/h21-23,30-31,48,56-68,70-84,92-93,150-152H,19-20,24-29,32-47,49-55,116-120H2,1-18H3,(H2,121,153)(H,123,161)(H,124,168)(H,125,169)(H,126,181)(H,128,155)(H,129,178)(H,130,171)(H,131,173)(H,132,172)(H,133,179)(H,134,156)(H,135,158)(H,136,157)(H,137,163)(H,138,174)(H,139,164)(H,140,165)(H,141,167)(H,142,176)(H,143,182)(H,144,162)(H,145,170)(H,146,175)(H,147,154)(H,148,180)(H,159,160)(H,149,166,177)/t61-,62-,63-,64-,65-,66-,67-,68-,70?,71-,72-,73-,74-,75-,76-,77-,78-,79-,80-,81-,82-,83-,84-,92-,93-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=NCC(=N[C@@H](C)C(=N[C@@H](CO)C(=N[C@@H]([C@@H](C)CC)C(=N[C@@H](CC(C)C)C(=N[C@@H](CO)C(=N[C@@H](C)C(=NCC(=N[C@@H](CCCCN)C(=N[C@@H](CO)C(=N[C@@H](C)C(=N[C@@H](CC(C)C)C(=N[C@@H](CCCCN)C(=NCC(=N[C@@H](CC(C)C)C(=N[C@@H](C)C(=N[C@@H](CCCCN)C(=NCC(=N[C@@H](CC(C)C)C(=N[C@@H](C)C(=NC(=O)[C@H](CC(=O)O)N=C([C@H](C)N=C([C@H](Cc1ccccc1)N=C([C@H](CC1C=NC=N1)N=C([C@H](CCC(=N)O)N)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)N=C(CN)O
Synonyms:- Blp-1
- L-Aspartamide, glycyl-L-isoleucylglycyl-L-alanyl-L-seryl-L-isoleucyl-L-leucyl-L-seryl-L-alanylglycyl-L-lysyl-L-seryl-L-alanyl-L-leucyl-L-lysylglycyl-L-leucyl-L-alanyl-L-lysylglycyl-L-leucyl-L-alanyl-L-alpha-glutamyl-L-
- Bombinin-like peptide-1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
L-Aspartamide, glycyl-L-isoleucylglycyl-L-alanyl-L-seryl-L-isoleucyl-L-leucyl-L-seryl-L-alanylglycyl-L-lysyl-L-seryl-L-alanyl-L-leucyl-L-lysylglycyl-L-leucyl-L-alanyl-L-lysylglycyl-L-leucyl-L-alanyl-L-α-glutamyl-L-histidyl-L-phenylalanyl-L-alanyl- (9CI)
CAS:Formula:C115H194N34O33Molecular weight:2580.9789Bombinin-Like Peptide (BLP-1)
CAS:Bombinin-Like Peptide (BLP-1) is an antimicrobial peptide from Bombina species.Formula:C115H194N34O33Purity:98%Color and Shape:SolidMolecular weight:2580.98Bombinin-Like Peptide (BLP-1)
CAS:Custom research peptide; min purity 95%. For different specs please use the Peptide Quote ToolFormula:C115H194N34O33Molecular weight:2,581.04 g/molBombinin-like peptide (blp-1)
CAS:<p>Bombinin-like peptide (blp-1) is an antimicrobial peptide, which is derived from the skin secretion of certain amphibians, specifically the *Bombina* species of frogs. This peptide functions by disrupting microbial cell membranes, leading to cell lysis and death. Its ability to compromise the integrity of the cell membrane makes it effective against a range of pathogenic microorganisms, including bacteria and fungi.</p>Formula:C115H194N34O33Purity:Min. 95%Molecular weight:2,581 g/mol


