CAS 138247-14-0
:ethyl 5-(4-hexylphenyl)-5-oxo-pentanoate
Description:
Ethyl 5-(4-hexylphenyl)-5-oxo-pentanoate, identified by its CAS number 138247-14-0, is an organic compound characterized by its ester functional group, which is typical of many compounds in the ester category. This substance features a pentanoate backbone, indicating a five-carbon chain, and is substituted with a phenyl group that has a hexyl side chain, contributing to its hydrophobic characteristics. The presence of the keto group (5-oxo) suggests that it may participate in various chemical reactions, including condensation and nucleophilic addition. Ethyl esters like this compound are often used in organic synthesis and may exhibit interesting biological activities, making them of interest in medicinal chemistry. The molecular structure implies potential applications in the development of pharmaceuticals or agrochemicals. Additionally, the compound's physical properties, such as solubility and boiling point, would be influenced by its molecular weight and the nature of its substituents, which can affect its behavior in different environments. Overall, ethyl 5-(4-hexylphenyl)-5-oxo-pentanoate represents a complex organic molecule with potential utility in various chemical applications.
Formula:C19H28O3
InChI:InChI=1/C19H28O3/c1-3-5-6-7-9-16-12-14-17(15-13-16)18(20)10-8-11-19(21)22-4-2/h12-15H,3-11H2,1-2H3
SMILES:CCCCCCc1ccc(cc1)C(=O)CCCC(=O)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
