CAS 138247-17-3
:ethyl 5-oxo-5-(4-phenylphenyl)pentanoate
Description:
Ethyl 5-oxo-5-(4-phenylphenyl)pentanoate, identified by its CAS number 138247-17-3, is an organic compound characterized by its ester functional group and a complex structure that includes a phenyl substituent. This compound features a five-carbon chain with a ketone group at the fifth position, contributing to its reactivity and potential applications in organic synthesis. The presence of the ethyl ester group enhances its solubility in organic solvents, making it suitable for various chemical reactions. Ethyl 5-oxo-5-(4-phenylphenyl)pentanoate may exhibit interesting properties such as moderate volatility and potential biological activity, which could be explored in medicinal chemistry. Its structural features suggest that it may participate in reactions typical of ketones and esters, such as nucleophilic additions or condensation reactions. Overall, this compound's unique structure and functional groups make it a candidate for further research in synthetic organic chemistry and potential applications in pharmaceuticals or materials science.
Formula:C19H20O3
InChI:InChI=1/C19H20O3/c1-2-22-19(21)10-6-9-18(20)17-13-11-16(12-14-17)15-7-4-3-5-8-15/h3-5,7-8,11-14H,2,6,9-10H2,1H3
SMILES:CCOC(=O)CCCC(=O)c1ccc(cc1)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.