CAS 138247-19-5
:ethyl 5-oxo-5-(4-pentoxyphenyl)pentanoate
Description:
Ethyl 5-oxo-5-(4-pentoxyphenyl)pentanoate, with the CAS number 138247-19-5, is an organic compound characterized by its ester functional group, which is typical of many compounds in the ester category. This substance features a pentanoate backbone, indicating a five-carbon chain with a ketone group at the 5-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the 4-pentoxyphenyl group suggests that it has aromatic characteristics, which can influence its solubility and interaction with other molecules. Generally, compounds like this may exhibit moderate to high lipophilicity due to the alkyl and aromatic groups, affecting their behavior in biological systems and their potential use in pharmaceuticals or agrochemicals. Additionally, the compound's structure may allow for various chemical reactions, such as hydrolysis or transesterification, making it a versatile intermediate in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C18H26O4
InChI:InChI=1/C18H26O4/c1-3-5-6-14-22-16-12-10-15(11-13-16)17(19)8-7-9-18(20)21-4-2/h10-13H,3-9,14H2,1-2H3
SMILES:CCCCCOc1ccc(cc1)C(=O)CCCC(=O)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
