CymitQuimica logo

CAS 13827-62-8

:

Naphthalene-2,6-disulfonyl dichloride

Description:
Naphthalene-2,6-disulfonyl dichloride, with the CAS number 13827-62-8, is an organic compound characterized by its sulfonyl chloride functional groups attached to a naphthalene ring. This compound typically appears as a white to light yellow crystalline solid and is known for its reactivity due to the presence of two sulfonyl chloride groups, which can undergo nucleophilic substitution reactions. It is primarily used as a reagent in organic synthesis, particularly in the preparation of sulfonamide derivatives and other sulfonyl-containing compounds. The presence of chlorine atoms enhances its electrophilic character, making it a useful intermediate in various chemical transformations. Naphthalene-2,6-disulfonyl dichloride is soluble in organic solvents such as dichloromethane and chloroform but is generally insoluble in water. Due to its reactive nature, it should be handled with care, as it can be corrosive and may cause irritation upon contact with skin or mucous membranes. Proper safety precautions, including the use of personal protective equipment, are essential when working with this compound.
Formula:C10H6Cl2O4S2
InChI:InChI=1/C10H6Cl2O4S2/c11-17(13,14)9-3-1-7-5-10(18(12,15)16)4-2-8(7)6-9/h1-6H
InChI key:VPLHHUICIOEESV-UHFFFAOYSA-N
SMILES:c1cc(cc2ccc(cc12)S(=O)(=O)Cl)S(=O)(=O)Cl
Found 4 products.