CAS 138300-59-1: 2-Chloromethyl-5-Cyclopropyl-1,3,4-Thiadiazole
Description:2-Chloromethyl-5-Cyclopropyl-1,3,4-Thiadiazole is a heterocyclic compound characterized by the presence of a thiadiazole ring, which consists of two nitrogen atoms and one sulfur atom in a five-membered ring structure. The compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The cyclopropyl group contributes to its unique structural properties, influencing its steric and electronic characteristics. This compound is typically of interest in medicinal chemistry and material science due to its potential biological activity and applications in drug development. Its reactivity can be attributed to the presence of the chloromethyl group, which can participate in nucleophilic substitution reactions. Additionally, the thiadiazole moiety is known for its diverse pharmacological properties, including antimicrobial and anti-inflammatory activities. Overall, 2-Chloromethyl-5-Cyclopropyl-1,3,4-Thiadiazole represents a versatile scaffold for the synthesis of novel compounds in various chemical research fields.
Formula:C6H7ClN2S
InChI:InChI=1/C6H7ClN2S/c7-3-5-8-9-6(10-5)4-1-2-4/h4H,1-3H2
- Synonyms:
- 1,3,4-Thiadiazole, 2-(chloromethyl)-5-cyclopropyl-
- 2-(chloromethyl)-5-cyclopropyl-1,3,4-thiadiazole

2-Chloromethyl-5-cyclopropyl-1,3,4-thiadiazole
Ref: 10-F009919
1g | 709.00 € |

1,3,4-Thiadiazole, 2-(chloromethyl)-5-cyclopropyl-
Ref: IN-DA0018GV
Undefined size | To inquire |

2-Chloromethyl-5-cyclopropyl-1,3,4-thiadiazole
Ref: 3D-NFA30059
1g | 856.00 € | ||
100mg | 400.00 € |