CAS 138326-69-9: Cyclopropaneacetic acid, α-amino-, methyl ester, hydrochloride, (R)-
Description:Cyclopropaneacetic acid, α-amino-, methyl ester, hydrochloride, (R)- is a chiral compound characterized by its cyclopropane ring structure, which contributes to its unique chemical properties. As an α-amino acid derivative, it contains both an amino group and a carboxylic acid group, making it a potential building block for peptide synthesis. The methyl ester form indicates that the carboxylic acid group is esterified with a methyl group, enhancing its lipophilicity and potentially influencing its biological activity. The hydrochloride salt form suggests increased solubility in water, which is advantageous for pharmaceutical applications. The (R)- designation indicates the specific stereochemistry of the molecule, which can significantly affect its interaction with biological systems, including receptors and enzymes. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its unique structural features and stereochemistry are critical for its function and potential therapeutic applications.
Formula:C6H11NO2·ClH
InChI:InChI=1S/C6H11NO2.ClH/c1-9-6(8)5(7)4-2-3-4;/h4-5H,2-3,7H2,1H3;1H/t5-;/m1./s1
InChI key:InChIKey=SRMSADQSMWKRRW-NUBCRITNSA-N
SMILES:Cl.O=C(OC)C(N)C1CC1
- Synonyms:
- Cyclopropaneacetic acid, α-amino-, methyl ester, hydrochloride, (R)-
- (R)-Amino-cyclopropyl-acetic acid methyl ester hydrochloride
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Cyclopropaneacetic acid, α-amino-, methyl ester, hydrochloride, (R)- (9CI) REF: IN-DA0018JTCAS: 138326-69-9 | 95% | To inquire | Mon 14 Apr 25 |
 | (R)-Amino-cyclopropyl-acetic acid methyl ester hydrochloride REF: 10-F606728CAS: 138326-69-9 | 95% | 357.00 €~1,416.00 € | Thu 17 Apr 25 |
 | Methyl (R)-A-amino-cyclopropaneacetate hydrochloride REF: 3D-NFA32669CAS: 138326-69-9 | Min. 95% | - - - | Discontinued product |
Cyclopropaneacetic acid, α-amino-, methyl ester, hydrochloride, (R)- (9CI)
Ref: IN-DA0018JT
| 50mg | 120.00 € | ||
| 100mg | 177.00 € | ||
| 250mg | 209.00 € |
(R)-Amino-cyclopropyl-acetic acid methyl ester hydrochloride
Ref: 10-F606728
| 1g | 453.00 € | ||
| 5g | 1,416.00 € | ||
| 500mg | 357.00 € |
Methyl (R)-A-amino-cyclopropaneacetate hydrochloride
Ref: 3D-NFA32669
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
