CAS 138373-23-6

5-Hydroxyaloin A

Description:

5-Hydroxyaloin A is a naturally occurring compound classified as a phenolic compound, specifically a type of anthraquinone derivative. It is primarily derived from the Aloe species, particularly Aloe vera, and is known for its potential therapeutic properties. This compound exhibits antioxidant, anti-inflammatory, and antimicrobial activities, making it of interest in both pharmacological and cosmetic applications. Structurally, 5-Hydroxyaloin A features a hydroxyl group that contributes to its reactivity and biological activity. Its chemical properties include solubility in organic solvents, which is typical for phenolic compounds, and it may undergo various chemical reactions such as oxidation and conjugation. The compound's safety profile and efficacy in medicinal applications are subjects of ongoing research, particularly in the context of traditional medicine and modern pharmacology. Overall, 5-Hydroxyaloin A represents a significant area of study due to its potential health benefits and applications in various industries.

Formula: C₂₁H₂₂O₁₀

InChI: InChI=1S/C21H22O10/c22-5-7-3-8-13(11(26)4-7)18(28)16-10(25)2-1-9(24)15(16)14(8)21-20(30)19(29)17(27)12(6-23)31-21/h1-4,12,14,17,19-27,29-30H,5-6H2/t12-,14-,17-,19+,20-,21+/m1/s1

InChI key: InChIKey=LJCDCYLYUCZUGL-UQBALUMJSA-N

SMILES: OC1=C2[C@@](C=3C(C(=O)C2=C(O)C=C1)=C(O)C=C(CO)C3)([C@@]4(O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[H])[H]

Synonyms:

• (10R)-10-β-D-Glucopyranosyl-1,5,8-trihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone
• 9(10H)-Anthracenone, 10-β-D-glucopyranosyl-1,5,8-trihydroxy-3-(hydroxymethyl)-, (10R)-
• 5-Hydroxyaloin A

5-Hydroxyaloin A

CAS: 138373-23-6

5-Hydroxyaloin A is an anthraquinone derivative, which is a chemical compound typically sourced from the Aloe plant. Aloe species are well-known for their diverse phytochemical constituents, which include anthraquinones that possess various biological activities. The mode of action of 5-Hydroxyaloin A involves interacting with cellular pathways to elicit potential anti-inflammatory and antioxidant effects. As a result, it influences cellular oxidative stress and inflammatory responses.

Formula: C₂₁H₂₂O₁₀

Purity: Min. 95%

Molecular weight: 434.39 g/mol

Ref: 3D-FH165627

5-Hydroxyaloin A

CAS: 138373-23-6

Formula: C₂₁H₂₂O₁₀

Molecular weight: 434.4

Ref: ST-EA-CP-A296005

5-Hydroxyaloin A

CAS: 138373-23-6

Formula: C₂₁H₂₂O₁₀

Molecular weight: 434.40

Ref: 4Z-A-254004