CAS 1383776-63-3

2-Methyl-1-pyrrolidinecarbonyl chloride

Description:

2-Methyl-1-pyrrolidinecarbonyl chloride, identified by its CAS number 1383776-63-3, is a chemical compound characterized by the presence of a pyrrolidine ring substituted with a carbonyl chloride group. This compound typically exhibits a colorless to pale yellow liquid form and is known for its reactivity, particularly due to the presence of the carbonyl chloride functional group, which can participate in nucleophilic acyl substitution reactions. It is often utilized in organic synthesis as an acylating agent, facilitating the introduction of acyl groups into various substrates. The compound's structure suggests it may have moderate polarity, influencing its solubility in organic solvents. Additionally, it may pose hazards such as corrosiveness and toxicity, necessitating careful handling and storage under appropriate safety protocols. Overall, 2-Methyl-1-pyrrolidinecarbonyl chloride serves as a valuable intermediate in the synthesis of more complex organic molecules, particularly in pharmaceutical and agrochemical applications.

Formula: C₆H₁₀ClNO

InChI: InChI=1S/C6H10ClNO/c1-5-3-2-4-8(5)6(7)9/h5H,2-4H2,1H3

InChI key: InChIKey=PYNWJDARHGISNW-UHFFFAOYSA-N

SMILES: C(Cl)(=O)N1C(C)CCC1

Synonyms:

• 2-Methylpyrrolidine-1-carbonyl chloride
• 1-Pyrrolidinecarbonyl chloride, 2-methyl-
• 2-Methyl-1-pyrrolidinecarbonyl chloride

2-Methylpyrrolidine-1-carbonyl chloride

CAS: 1383776-63-3

Versatile small molecule scaffold

Formula: C₆H₁₀ClNO

Purity: Min. 95%

Molecular weight: 147.6 g/mol

Ref: 3D-IFC77663