CymitQuimica logo

CAS 1383985-28-1

:

3-Bromo-5-(methoxymethyl)benzonitrile

Description:
3-Bromo-5-(methoxymethyl)benzonitrile is an organic compound characterized by its aromatic structure, which includes a bromine atom and a methoxymethyl group attached to a benzonitrile framework. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The methoxymethyl group contributes to the compound's overall hydrophobic character while also providing potential sites for further chemical modifications. As a benzonitrile derivative, it features a nitrile functional group (-C≡N), which is known for its ability to participate in nucleophilic reactions and can serve as a precursor for various synthetic pathways. This compound may exhibit interesting properties such as solubility in organic solvents and potential applications in pharmaceuticals or materials science. Its specific reactivity and interactions would depend on the surrounding conditions, including solvent, temperature, and the presence of other reagents. Overall, 3-Bromo-5-(methoxymethyl)benzonitrile is a versatile compound with potential utility in organic synthesis and medicinal chemistry.
Formula:C9H8BrNO
InChI:InChI=1S/C9H8BrNO/c1-12-6-8-2-7(5-11)3-9(10)4-8/h2-4H,6H2,1H3
InChI key:InChIKey=QZNMZCQEXYOFBG-UHFFFAOYSA-N
SMILES:C(OC)C1=CC(C#N)=CC(Br)=C1
Synonyms:
  • Benzonitrile, 3-bromo-5-(methoxymethyl)-
  • 3-Bromo-5-(methoxymethyl)benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.