CAS 138402-13-8

Tetrahydro-4-[[(phenylmethoxy)carbonyl]amino]-2H-pyran-4-carboxylic acid

Description:

Tetrahydro-4-[[(phenylmethoxy)carbonyl]amino]-2H-pyran-4-carboxylic acid, with the CAS number 138402-13-8, is a chemical compound characterized by its complex structure, which includes a pyran ring and various functional groups. This compound features a tetrahydrofuran moiety, indicating it is a saturated derivative of pyran, which contributes to its stability and solubility in organic solvents. The presence of a phenylmethoxycarbonyl group suggests it has potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The carboxylic acid functional group indicates that it can participate in acid-base reactions and may serve as a precursor for further chemical modifications. Its unique structure may also impart specific biological activities, making it of interest in drug discovery. Overall, this compound exemplifies the intricate interplay of functional groups that can influence its reactivity, solubility, and potential applications in various fields of chemistry.

Formula: C₁₄H₁₇NO₅

InChI: InChI=1S/C14H17NO5/c16-12(17)14(6-8-19-9-7-14)15-13(18)20-10-11-4-2-1-3-5-11/h1-5H,6-10H2,(H,15,18)(H,16,17)

InChI key: InChIKey=KBGZJANMFZSOFP-UHFFFAOYSA-N

SMILES: N(C(OCC1=CC=CC=C1)=O)C2(C(O)=O)CCOCC2

Synonyms:

• 2H-Pyran-4-carboxylic acid, tetrahydro-4-[[(phenylmethoxy)carbonyl]amino]-
• Tetrahydro-4-[[(phenylmethoxy)carbonyl]amino]-2H-pyran-4-carboxylic acid
• 4-[[(Benzyloxy)carbonyl]amino]oxane-4-carboxylic acid

2H-Pyran-4-carboxylic acid, tetrahydro-4-[[(phenylmethoxy)carbonyl]amino]-

CAS: 138402-13-8

Formula: C₁₄H₁₇NO₅

Purity: %

Molecular weight: 279.2885

Ref: IN-DA0018Q5

4-Cbz-amino-4-tetrahydropyrancarboxylic acid

CAS: 138402-13-8

4-Cbz-amino-4-tetrahydropyrancarboxylic acid

Purity: 97%

Molecular weight: 279.29g/mol

Ref: 54-OR926187